A3329112
1,3-Dibromo-5-(trifluoromethoxy)benzene , 98% , 207226-31-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5G | RMB49.60 | In Stock |
|
| 25G | RMB175.20 | In Stock |
|
| 100G | RMB495.20 | In Stock |
|
| 500g | RMB2245.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 83-85 °C/20 mmHg (lit.) |
| Density | 1.96 |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Colorless |
| InChI | 1S/C7H3Br2F3O/c8-4-1-5(9)3-6(2-4)13-7(10,11)12/h1-3H |
| InChIKey | UKHOUWWEEAOCTI-UHFFFAOYSA-N |
| SMILES | FC(F)(F)Oc1cc(Br)cc(Br)c1 |
| CAS DataBase Reference | 207226-31-1(CAS DataBase Reference) |
Description and Uses
1,3-Dibromo-5-(trifluoromethoxy)benzene may be used in chemical synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2909309090 |
| Storage Class | 10 - Combustible liquids |







