dehydroepiandrosterone sulfate sodium salt , >99% , 1099-87-2
Synonym(s):
Dehydroepiandrosterone 3-sulfate sodium salt
CAS NO.:1099-87-2
Empirical Formula: C19H27NaO5S
Molecular Weight: 390.47
MDL number: MFCD00010470
EINECS: 214-152-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB639.20 | In Stock |
|
| 10MG | RMB1399.20 | In Stock |
|
| 25MG | RMB2630.40 | In Stock |
|
| 100MG | RMB5328.00 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 148-149 °C (dec.)(lit.) |
| refractive index | 10 ° (C=4, MeOH) |
| Flash point: | 9℃ |
| storage temp. | -20°C |
| solubility | methanol: clear to hazy |
| form | powder |
| color | white to off-white |
| Merck | 14,2871 |
| Major Application | clinical testing |
| InChIKey | GFJWACFSUSFUOG-QGVZUKINNA-M |
| SMILES | [C@]12([H])CC[C@]3(C)C(CC[C@@]3([H])[C@]1([H])CC=C1C[C@@H](OS([O-])(=O)=O)CC[C@]21C)=O.[Na+] |&1:0,4,9,11,17,25,r| |
| CAS DataBase Reference | 1099-87-2(CAS DataBase Reference) |
Description and Uses
Dehydroepiandrosterone sulfate (DHEAS) is a metabolite of dehydroepiandrosterone that is the major secretory product of adrenal glands and is the predominant circulating precursor for active steroid hormones in humans. For example, in the fetoplacental-
An active agent in the preparation of a pharmaceutical for the treatment of asthma or other respiratory diseases.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P260-P280-P301+P310-P311 |
| target organs | Eyes |
| Hazard Codes | F,C,T |
| Risk Statements | 11-34-39/23/24/25-23/24/25 |
| Safety Statements | 16-26-36/37/39-45-36/37-7 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 3 |
| RTECS | BV8397400 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| Toxicity | dog,LD50,intravaginal,> 500mg/kg (500mg/kg),Gekkan Yakuji. Pharmaceuticals Monthly. Vol. 40, Pg. 444, 1998. |





