A3338812
1,2-didecanoyl-sn-glycero-3-phosphocholine , >99% , 3436-44-0
Synonym(s):
1,2-dicapryl-sn-glycero-3-phosphocholine; PC(10:0/10:0)
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB439.20 | In Stock |
|
| 100MG | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | −20°C |
| solubility | Ethanol: 30 mg/ml; DMF: 20 mg/ml; DMSO: 20 mg/ml; Ethanol:PBS (pH 7.2)(1:1): 0.5 mg/ml |
| form | powder |
| color | White to off-white |
| BRN | 3757665 |
| InChI | 1S/C28H56NO8P/c1-6-8-10-12-14-16-18-20-27(30)34-24-26(25-36-38(32,33)35-23-22-29(3,4)5)37-28(31)21-19-17-15-13-11-9-7-2/h26H,6-25H2,1-5H3 |
| InChIKey | MLKLDGSYMHFAOC-UHFFFAOYSA-N |
| SMILES | [O-]P(OCC[N+](C)(C)C)(OC[C@]([H])(OC(CCCCCCCCC)=O)COC(CCCCCCCCC)=O)=O |
Description and Uses
Phosphatidylcholine species are a common class of phospholipids that comprise the mammalian cell membrane. 1,2-Didecanoyl PC (DPC) is a synthetic, less hydrophobic phospholipid that has been found to be useful for enhancing the absorption of peptide drugs and hormones such as insulin. Thus, the bioavailability of intranasally applied human growth hormone is enhanced when coadministered with the absorption enhancer DPC.
1,2-Didecanoyl PC is a synthetic phospholipid.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H331-H336-H351-H361d-H372 |
| Precautionary statements | P202-P301+P312-P302+P352-P304+P340+P311-P305+P351+P338-P308+P313 |
| WGK Germany | 3 |
| F | 10-21 |
| Storage Class | 11 - Combustible Solids |








