A3355012
D-Mannosamine hydrochloride , ≥98% , 5505-63-5
Synonym(s):
D -Mannosamine hydrochloride;2-Amino-2-deoxy-D -mannose hydrochloride
CAS NO.：5505-63-5
Empirical Formula: C6H14ClNO5
Molecular Weight: 215.63
MDL number: MFCD00064557
EINECS: 226-847-8
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB31.20 | In Stock |
|
| 500MG | RMB79.20 | In Stock |
|
| 1G | RMB119.20 | In Stock |
|
| 5g | RMB407.20 | In Stock |
|
| 10g | RMB767.20 | In Stock |
|
| 25g | RMB1655.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| form | Powder |
| color | White to Off-white |
| biological source | crab (shell) shrimp shells |
| Water Solubility | Soluble in water and methanol. |
| Sensitive | Hygroscopic |
| BRN | 3914860 |
| InChI | InChI=1/C6H13NO5.ClH/c7-3-5(10)4(9)2(1-8)12-6(3)11;/h2-6,8-11H,1,7H2;1H/t2-,3+,4-,5-,6?;/s3 |
| InChIKey | QKPLRMLTKYXDST-OHXGPSCHSA-N |
| SMILES | [C@H]1(CO)OC([C@@H](N)[C@@H](O)[C@@H]1O)O.Cl |&1:0,5,7,9,r| |
| CAS DataBase Reference | 5505-63-5(CAS DataBase Reference) |
| EPA Substance Registry System | D-Mannose, 2-amino-2-deoxy-, hydrochloride (5505-63-5) |
Description and Uses
D-Mannosamine hydrochloride is a pharmaceutical compound used in the development of mannosylated liposomes for bioadhesive oral drug delivery via M cells of Peyer's patches.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264b-P270-P271-P272-P280-P302+P352-P304+P340-P305+P351+P338-P310-P330-P362+P364-P403+P233-P501c |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| F | 3-10 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HS Code | 29329985 |
