PRODUCT Properties
| Melting point: | 296-298 °C |
| Boiling point: | 530.6±45.0 °C(Predicted) |
| Density | 1.203±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 10.01±0.10(Predicted) |
| color | Off-White to Pale Yellow |
| BRN | 2059947 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C25H20O2/c26-23-15-11-21(12-16-23)25(19-7-3-1-4-8-19,20-9-5-2-6-10-20)22-13-17-24(27)18-14-22/h1-18,26-27H |
| InChIKey | BATCUENAARTUKW-UHFFFAOYSA-N |
| SMILES | OC(C=C1)=CC=C1C(C2=CC=C(O)C=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
| CAS DataBase Reference | 1844-01-5(CAS DataBase Reference) |
Description and Uses
4,4''-Dihydroxytetraphenylmethane can be used for selective self-assembly of organometallic diacetylide gold(I) macrocyclic rings and catenanes. It is also used to synthesize anion conductive multiblock copolymers for fuel cell applications.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H413 |
| Precautionary statements | P273-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-53 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2907.29.9000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
