A3364412
3,5-Di-tert-butyl-4-hydroxybenzaldehyde , ≥98.0%(HPLC) , 1620-98-0
CAS NO.:1620-98-0
Empirical Formula: C15H22O2
Molecular Weight: 234.33
MDL number: MFCD00008826
EINECS: 216-592-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB87.20 | In Stock |
|
| 100G | RMB295.20 | In Stock |
|
| 500G | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186-190 °C |
| Boiling point: | 336.66°C (rough estimate) |
| Density | 1.0031 (rough estimate) |
| refractive index | 1.5542 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in hot methanol. |
| pka | 8.33±0.40(Predicted) |
| form | Crystalline Powder |
| color | Light yellow to yellow-beige |
| Sensitive | Air Sensitive |
| BRN | 982526 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C15H22O2/c1-14(2,3)11-7-10(9-16)8-12(13(11)17)15(4,5)6/h7-9,17H,1-6H3 |
| InChIKey | DOZRDZLFLOODMB-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 |
| CAS DataBase Reference | 1620-98-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Di-tert-butyl-4-hydroxybenzaldehyde(1620-98-0) |
Description and Uses
3,5-Di-tert-butyl-4-hydroxybenzaldehyde is employed as an OLED materials. It is also used as a pharmaceutical intermediate. The derivatives of this compound possess equipotent anti-inflammatory activities to indomethacin.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-36-25 |
| Safety Statements | 24/25-45-26-36/37 |
| WGK Germany | WGK 3 |
| RTECS | CU5610070 |
| Hazard Note | Irritant |
| HS Code | 29124990 |
| Storage Class | 11 - Combustible Solids |





