A3365312
Dodecamethylpentasiloxane , 95% , 141-63-9
CAS NO.:141-63-9
Empirical Formula: C12H36O4Si5
Molecular Weight: 384.84
MDL number: MFCD00039795
EINECS: 205-492-2
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB44.80 | In Stock |
|
| 5ml | RMB143.20 | In Stock |
|
| 25ml | RMB406.40 | In Stock |
|
| 100ml | RMB1180.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -81 °C (lit.) |
| Boiling point: | 230 °C (lit.) |
| Density | 0.875 g/mL at 25 °C (lit.) |
| vapor pressure | <1 mm Hg ( 20 °C) |
| refractive index | n |
| Flash point: | 187 °F |
| storage temp. | Refrigerator |
| solubility | Benzene (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | liquid |
| Specific Gravity | 0.876 |
| color | Colourless |
| Water Solubility | 70.41ng/L at 23℃ |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| Merck | 14,3404 |
| Dielectric constant | 2.5(20℃) |
| Cosmetics Ingredients Functions | ANTIFOAMING |
| InChI | 1S/C12H36O4Si5/c1-17(2,3)13-19(7,8)15-21(11,12)16-20(9,10)14-18(4,5)6/h1-12H3 |
| InChIKey | FBZANXDWQAVSTQ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| LogP | 9.411 at 25℃ |
| CAS DataBase Reference | 141-63-9(CAS DataBase Reference) |
| EPA Substance Registry System | Pentasiloxane, dodecamethyl- (141-63-9) |
Description and Uses
As a basis for silicone oils or fluids designed to withstand extremes of temperature; as a foam suppressant in petroleum lubricating oil.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| RTECS | SB0970000 |
| TSCA | TSCA listed |
| HS Code | 2931.90.9010 |
| Storage Class | 10 - Combustible liquids |
| Hazardous Substances Data | 141-63-9(Hazardous Substances Data) |
| Toxicity | guinea pig,LDLo,oral,50gm/kg (50000mg/kg),Journal of Industrial Hygiene and Toxicology. Vol. 30, Pg. 332, 1948. |







