A3367912
2,3-Dichloromaleic anhydride , 97% , 1122-17-4
CAS NO.：1122-17-4
Empirical Formula: C4Cl2O3
Molecular Weight: 166.95
MDL number: MFCD00005520
EINECS: 214-343-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB71.20 | In Stock |
|
| 25G | RMB311.20 | In Stock |
|
| 100G | RMB1159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~120 °C |
| Boiling point: | 118-125 °C |
| Density | 1.7168 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform, Methanol (Slightly, Heated) |
| form | Solid |
| color | White |
| BRN | 121027 |
| InChI | InChI=1S/C4Cl2O3/c5-1-2(6)4(8)9-3(1)7 |
| InChIKey | AGULWIQIYWWFBJ-UHFFFAOYSA-N |
| SMILES | O1C(=O)C(Cl)=C(Cl)C1=O |
| CAS DataBase Reference | 1122-17-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,5-Furandione, 3,4-dichloro-(1122-17-4) |
| EPA Substance Registry System | Dichloromaleic anhydride (1122-17-4) |
Description and Uses
Dichloromaleic Anhydride is a derivative of Maleic Anhydride (M124400) found to have considerable antifungal activity against Botrytis cinerea.
Safety
| Symbol(GHS) |    GHS05,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H341-H301+H311+H331-H314 |
| Precautionary statements | P260-P280-P361+P364 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | IRRITANT |
| HS Code | 2932190090 |
