A3368312
2,6-Difluorobenzoyl Chloride , 98% , 18063-02-0
CAS NO.:18063-02-0
Empirical Formula: C7H3ClF2O
Molecular Weight: 176.55
MDL number: MFCD00003238
EINECS: 241-971-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB135.20 | In Stock |
|
| 100G | RMB480.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-132 °C(lit.) |
| Boiling point: | 72-77 °C/13 mmHg (lit.) |
| Density | 1.404 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 121 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.404 |
| Water Solubility | REACTS |
| Sensitive | Moisture Sensitive |
| BRN | 639438 |
| InChI | InChI=1S/C7H3ClF2O/c8-7(11)6-4(9)2-1-3-5(6)10/h1-3H |
| InChIKey | QRHUZEVERIHEPT-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=C(F)C=CC=C1F |
| CAS DataBase Reference | 18063-02-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,6-Difluorobenzoyl chloride(18063-02-0) |
Description and Uses
2,6-Difluorobenzoyl chloride has been used in:
- the preparation of series of novel 2-aryl substituted 4H-3,1-benzoxazin-4-ones
- regioselective synthesis of 3,6-disubstituted-2-aminoimidazo[1,2-a]pyridine
- Friedel-Crafts acylation reaction of toluene, anisol, thioanisol, 4-phenoxyacetophenone and N,N-diacetyl-4-phenoxyaniline
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 36/37/38-34-10 |
| Safety Statements | 26-36/37/39-45-28A-16 |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| RTECS | LV1763000 |
| F | 21 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






