A3370912
2-Dimethylaminobenzoic acid , 98% , 610-16-2
CAS NO.:610-16-2
Empirical Formula: C9H11NO2
Molecular Weight: 165.19
MDL number: MFCD00016496
EINECS: 210-209-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB42.40 | In Stock |
|
| 1G | RMB100.00 | In Stock |
|
| 5G | RMB427.20 | In Stock |
|
| 25G | RMB1084.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71-72°C |
| Boiling point: | 293.03°C (rough estimate) |
| Density | 1.1603 (rough estimate) |
| refractive index | 1.5620 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 1.40±0.10(Predicted) |
| color | White to Orange to Green |
| Water Solubility | Insoluble in water. |
| BRN | 2089466 |
| InChI | InChI=1S/C9H11NO2/c1-10(2)8-6-4-3-5-7(8)9(11)12/h3-6H,1-2H3,(H,11,12) |
| InChIKey | DVVXXHVHGGWWPE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC=C1N(C)C |
| CAS DataBase Reference | 610-16-2(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2-(dimethylamino)- (610-16-2) |
Description and Uses
2-Dimethylaminobenzoic acid is used as a chemical and organic intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36-22 |
| Safety Statements | 26-36/37 |
| TSCA | TSCA listed |
| HS Code | 2922390090 |







