A3371012
Dimethyl 1，4-cyclohexanedione-2，5-dicarboxylate , ≥97% , 6289-46-9
CAS NO.：6289-46-9
Empirical Formula: C10H12O6
Molecular Weight: 228.2
MDL number: MFCD00001607
EINECS: 228-528-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB24.00 | In Stock |
|
| 5g | RMB24.00 | In Stock |
|
| 100G | RMB59.20 | In Stock |
|
| 500G | RMB239.20 | In Stock |
|
| 1kg | RMB464.00 | In Stock |
|
| 2.5kg | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154-157 °C |
| Boiling point: | 330°C (rough estimate) |
| Density | 1.3792 (rough estimate) |
| vapor pressure | 0-0.002Pa at 20-50℃ |
| refractive index | 1.6000 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 9.04±0.40(Predicted) |
| form | Fine Crystalline Powder |
| color | White to light yellow-green |
| Water Solubility | Soluble in water 0.0016 g/L. |
| InChI | InChI=1S/C10H12O6/c1-15-9(13)5-3-8(12)6(4-7(5)11)10(14)16-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | MHKKFFHWMKEBDW-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)CC(=O)C(C(OC)=O)CC1=O |
| LogP | 2.49 at 23℃ and pH7 |
| CAS DataBase Reference | 6289-46-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Cyclohexanedicarboxylic acid, 2,5-dioxo-, 1,4-dimethyl ester (6289-46-9) |
Description and Uses
Dimethyl 1,4-cyclohexanedione-2,5-dicarboxylate is used in the production of pigments such as pigment red 122 and pigment violet 19. It also can react with 2,4-diamino-phenol to get 2,5-bis-(3-amino-4-hydroxy-phenylamino)-cyclohexa-1,4-diene-1,4-dicarboxylic acid dimethyl ester.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P501-P210-P280-P370+P378-P403+P235 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 1 |
| TSCA | Yes |
| HS Code | 29145090 |
