PRODUCT Properties
| Melting point: | >350 °C(lit.) |
| Boiling point: | 496.2±37.0 °C(Predicted) |
| Density | 1.541 (estimate) |
| refractive index | 1.5605 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | slightly soluble |
| form | Powder |
| pka | 6.77±0.20(Predicted) |
| color | Pale yellow |
| Water Solubility | slightly soluble |
| InChI | InChI=1S/C5H4N4S2/c10-4-2-3(7-1-6-2)8-5(11)9-4/h1H,(H3,6,7,8,9,10,11) |
| InChIKey | VQPMXSMUUILNFZ-UHFFFAOYSA-N |
| SMILES | N1C2=C(NC(=S)NC2=S)NC=1 |
| CAS DataBase Reference | 5437-25-2(CAS DataBase Reference) |
Description and Uses
2,6-Dimercaptopurine can be used in theoretical evaluation of inhibition performance of purine corrosion inhibitors for mild steel.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | UO8475000 |
| HS Code | 29335990 |
