A3375212
2,6-Dimethoxybenzaldehyde , ≥97.0%(GC) , 3392-97-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB91.20 | In Stock |
|
| 25G | RMB309.60 | In Stock |
|
| 100G | RMB1167.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 96-98 °C (lit.) |
| Boiling point: | 285 °C (lit.) |
| Density | 1.1708 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| Flash point: | 285°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in Methanol (almost transparency). |
| form | Crystalline Powder |
| color | Yellow to beige |
| Sensitive | Air Sensitive |
| BRN | 908138 |
| InChI | InChI=1S/C9H10O3/c1-11-8-4-3-5-9(12-2)7(8)6-10/h3-6H,1-2H3 |
| InChIKey | WXSGQHKHUYTJNB-UHFFFAOYSA-N |
| SMILES | C(=O)C1=C(OC)C=CC=C1OC |
| LogP | 1.670 (est) |
| CAS DataBase Reference | 3392-97-0(CAS DataBase Reference) |
Description and Uses
2,6-Dimethoxybenzaldehyde has been used in the preparation of 2,6-dihydroxybenzaldehyde by demethylation with AlBr3.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HS Code | 29124990 |
