A3375712
2，4-dimethoxy-4’-hydroxybenzophenone , 97% , 41351-30-8
Synonym(s):
(2,4-Dimethoxyphenyl)-(4-hydroxyphenyl)methanone;2,4-Dimethoxy-4′-hydroxybenzophenone
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.80 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB344.00 | In Stock |
|
| 100G | RMB1308.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138-142 °C (lit.) |
| Boiling point: | 467.9±45.0 °C(Predicted) |
| Density | 1.206±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 7.73±0.15(Predicted) |
| color | Off-white to white |
| BRN | 2508320 |
| InChI | 1S/C15H14O4/c1-18-12-7-8-13(14(9-12)19-2)15(17)10-3-5-11(16)6-4-10/h3-9,16H,1-2H3 |
| InChIKey | QEHRETCJMLQPCR-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccc(O)cc2)c(OC)c1 |
| CAS DataBase Reference | 41351-30-8(CAS DataBase Reference) |
Description and Uses
2,4-DIMETHOXY-4'-HYDROXYBENZOPHENONE is used for solid-phase peptide synthesis with FMOC strategy
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
