A3380612
Dibenzothiophene-2-boronic Acid(contains varying amounts of Anhydride) , 97% , 668983-97-9
CAS NO.:668983-97-9
Empirical Formula: C12H9BO2S
Molecular Weight: 228.07
MDL number: MFCD01318982
EINECS: 688-282-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB96.00 | In Stock |
|
| 5G | RMB238.40 | In Stock |
|
| 25g | RMB680.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 480℃ |
| Density | 1.38 |
| Flash point: | 244℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 8.39±0.30(Predicted) |
| color | White |
| InChI | InChI=1S/C12H9BO2S/c14-13(15)8-5-6-12-10(7-8)9-3-1-2-4-11(9)16-12/h1-7,14-15H |
| InChIKey | CSLSCVHILGCSTE-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C2SC3=CC=CC=C3C2=C1)(O)O |
| CAS DataBase Reference | 668983-97-9 |
Description and Uses
Dibenzothiophene-2-boronic acid is a useful reagent in chemical processes and organic synthesis. It has various applications, including in the production of organic semiconductors like thiophene-based polymers and oligomers. Furthermore, it can be used as a building block in the synthesis of various fluorescent dyes, such as BODIPY and rhodamine derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H302-H302+H312+H332-H315-H319 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |




![Dibenzo[b,d]furan-2-ylboronic acid](https://img.chemicalbook.com/CAS/GIF/402936-15-6.gif)

