A3385212
2,5-Diaminohydroquinone dihydrochloride , 97% , 24171-03-7
CAS NO.：24171-03-7
Empirical Formula: C6H10Cl2N2O2
Molecular Weight: 213.06
MDL number: MFCD00239416
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB228.80 | In Stock |
|
| 1G | RMB647.20 | In Stock |
|
| 5G | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder |
| Appearance | White to off-white Solid |
| Sensitive | Air Sensitive |
| BRN | 5795549 |
| InChI | InChI=1S/C6H8N2O2.2ClH/c7-3-1-5(9)4(8)2-6(3)10;;/h1-2,9-10H,7-8H2;2*1H |
| InChIKey | NILKAWPWTYPHAH-UHFFFAOYSA-N |
| SMILES | C1(N)C=C(C(N)=CC=1O)O.Cl.Cl |
Description and Uses
2,5-Diaminohydroquinone dihydrochloride is used in the preparation of polymers, synthetically cross-linked polyimide and silica hybrid films.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| F | 10-23 |
| HazardClass | 6.1 |
| PackingGroup | III |
