A3390112
Diaveridine , Analysis standard , 5355-16-8
Synonym(s):
5-(3,4-Dimethoxybenzyl)-2,4-pyrimidinediamine
CAS NO.:5355-16-8
Empirical Formula: C13H16N4O2
Molecular Weight: 260.29
MDL number: MFCD00057349
EINECS: 226-333-3
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 233° |
| Boiling point: | 506.1±60.0 °C(Predicted) |
| Density | 1.252±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly) |
| pka | 7.11±0.10(Predicted) |
| form | Solid |
| color | White to Pale Yellow |
| Merck | 13,3017 |
| BRN | 258464 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C13H16N4O2/c1-18-10-4-3-8(6-11(10)19-2)5-9-7-16-13(15)17-12(9)14/h3-4,6-7H,5H2,1-2H3,(H4,14,15,16,17) |
| InChIKey | LDBTVAXGKYIFHO-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(CC2=CC=C(OC)C(OC)=C2)C(N)=N1 |
| CAS DataBase Reference | 5355-16-8(CAS DataBase Reference) |
Description and Uses
Antibacterial.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | UV8142000 |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





