A3391512
2,5-Dimethoxyphenylacetic Acid , ≥98% , 1758-25-4
CAS NO.：1758-25-4
Empirical Formula: C10H12O4
Molecular Weight: 196.2
MDL number: MFCD00004322
EINECS: 217-151-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB103.20 | In Stock |
|
| 5G | RMB301.60 | In Stock |
|
| 25G | RMB1293.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123-125 °C(lit.) |
| Boiling point: | 293.08°C (rough estimate) |
| Density | 1.2166 (rough estimate) |
| refractive index | 1.5430 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.03±0.10(Predicted) |
| form | powder to crystal |
| color | White to Yellow to Green |
| InChI | InChI=1S/C10H12O4/c1-13-8-3-4-9(14-2)7(5-8)6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12) |
| InChIKey | BBZDYQUXRFATHZ-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC(OC)=CC=C1OC |
| CAS DataBase Reference | 1758-25-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetic acid, 2,5-dimethoxyphenyl-(1758-25-4) |
| EPA Substance Registry System | Benzeneacetic acid, 2,5-dimethoxy- (1758-25-4) |
Description and Uses
2,5-Dimethoxybenzeneacetic Acid is a useful reagent for organic synthesis and also a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22-36/37 |
| Safety Statements | 22-24/25-36/37-26 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
