A3392912
Dimethyl fluoromalonate , 97% , 344-14-9
CAS NO.：344-14-9
Empirical Formula: C5H7FO4
Molecular Weight: 150.11
MDL number: MFCD00054680
EINECS: 670-542-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB135.20 | In Stock |
|
| 100G | RMB357.60 | In Stock |
|
| 500g | RMB1584.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 76 °C |
| Density | 1.4g/ml |
| refractive index | 1.4032 |
| Flash point: | 111-112°C/45mm |
| storage temp. | Store at room temperature |
| pka | 10.35±0.46(Predicted) |
| form | solid |
| color | Colourless to off-white / liquid |
| BRN | 1768414 |
| InChI | InChI=1S/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
| InChIKey | ZVXHZSXYHFBIEW-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(F)C(OC)=O |
| CAS DataBase Reference | 344-14-9(CAS DataBase Reference) |
Description and Uses
Dimethyl 2-fluoromalonate is used as an intermediate in organic synthesis.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | T,C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-23 2636/37/3945-20 |
| RIDADR | 3265 |
| Hazard Note | Toxic |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29171900 |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |
