A3393612
4,4-dimethyloxazolidine , ≥95% , 51200-87-4
CAS NO.:51200-87-4
Empirical Formula: C5H11NO
Molecular Weight: 101.15
MDL number: MFCD00154171
EINECS: 257-048-2
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB375.20 | In Stock |
|
| 250MG | RMB1066.40 | In Stock |
|
| 1g | RMB2346.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 189.55°C (rough estimate) |
| Density | 0.942 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 120 °F |
| storage temp. | 2-8°C, protect from light |
| pka | 8.41±0.40(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| Cosmetics Ingredients Functions | PRESERVATIVE |
| InChI | InChI=1S/C5H11NO/c1-5(2)3-7-4-6-5/h6H,3-4H2,1-2H3 |
| InChIKey | GUQMDNQYMMRJPY-UHFFFAOYSA-N |
| SMILES | O1CC(C)(C)NC1 |
| LogP | 1.11 at 25℃ |
| EPA Substance Registry System | 4,4-Dimethyloxazolidine (51200-87-4) |
Description and Uses
Oxazolidine A is a reagent that is used in?antimicrobial mixtures. It is particular useful for fighting Aspergillus brasiliensis.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H302+H312+H332-H315-H317-H319-H335 |
| Precautionary statements | P210-P260-P280-P301+P310 |
| Hazard Codes | Xn |
| Risk Statements | 10-20/21/22-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | 1993 |
| WGK Germany | 2 |
| RTECS | RP7211000 |
| TSCA | TSCA listed |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 2934999090 |
| Hazardous Substances Data | 51200-87-4(Hazardous Substances Data) |




![7a-Ethyltetrahydro-1H-oxazolo[3,4-c]oxazole](https://img.chemicalbook.com/CAS/GIF/7747-35-5.gif)

![4a,8b-Dihydro-2H-1,4-dioxa-8c-azapentaleno[1,6-ab]inden-2a(3H)-ylmethanol](https://img.chemicalbook.com/StructureFile/ChemBookStructure2/GIF/CB7471063.gif)
![(3,5-Diphenyl-1H,3H,5H-oxazolo[3,4-c]oxazol-7a(7H)-yl)methanol](https://img.chemicalbook.com/CAS/GIF/36778-78-6.gif)
