A3395512
2,5-Difluoronitrobenzene , ≥98.0%(GC) , 364-74-9
Synonym(s):
1,4-Difluoro-2-nitrobenzene
CAS NO.:364-74-9
Empirical Formula: C6H3F2NO2
Molecular Weight: 159.09
MDL number: MFCD00007054
EINECS: 206-663-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB64.80 | In Stock |
|
| 100G | RMB200.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -11.7 °C (lit.) |
| Boiling point: | 206.5 °C (lit.) |
| Density | 1.467 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 194 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Clear yellow |
| Specific Gravity | 1.467 |
| Water Solubility | insoluble |
| BRN | 2210200 |
| InChI | InChI=1S/C6H3F2NO2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H |
| InChIKey | XNJAYQHWXYJBBD-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(F)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 364-74-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,5-Difluoronitrobenzene(364-74-9) |
Description and Uses
2,5-Difluoronitrobenzene was used in the synthesis of :
- N-alkylated 2-arylaminobenzimidazoles
- quinoxalinones
- N-(2-nitro-4-fluorophenyl)-l,2,3,4-tetrahydroisoquinoline
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | CZ5715000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



