A3398712
Dimethyl 2,3-Pyridinedicarboxylate , ≥98.0%(GC) , 605-38-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB36.00 | In Stock |
|
| 25G | RMB126.40 | In Stock |
|
| 100G | RMB479.20 | In Stock |
|
| 500g | RMB2063.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56°C |
| Boiling point: | 262.3±20.0 °C(Predicted) |
| Density | 1.231±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -0.83±0.10(Predicted) |
| form | Solid |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C9H9NO4/c1-13-8(11)6-4-3-5-10-7(6)9(12)14-2/h3-5H,1-2H3 |
| InChIKey | YLGIBCYHQZTFQL-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)=NC=CC=C1C(OC)=O |
| CAS DataBase Reference | 605-38-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,3-Pyridinedicarboxylic acid, dimethyl ester(605-38-9) |
Description and Uses
Dimethyl 2,3-Pyridinedicarboxylate is a reagent in the preparation of diarylcyclopentenopyridines as endothelin receptor antagonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2933399990 |
