A3403512
Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate , 97% , 2436-79-5
CAS NO.：2436-79-5
Empirical Formula: C12H17NO4
Molecular Weight: 239.27
MDL number: MFCD00005218
EINECS: 219-431-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB64.00 | In Stock |
|
| 25G | RMB257.60 | In Stock |
|
| 100G | RMB784.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 135-136 °C(lit.) |
| Boiling point: | 381.93°C (rough estimate) |
| Density | 1.1724 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 14.69±0.50(Predicted) |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C12H17NO4/c1-5-16-11(14)9-7(3)10(13-8(9)4)12(15)17-6-2/h13H,5-6H2,1-4H3 |
| InChIKey | XSBSXJAYEPDGSF-UHFFFAOYSA-N |
| SMILES | N1C(C)=C(C(OCC)=O)C(C)=C1C(OCC)=O |
| LogP | 3.850 (est) |
| CAS DataBase Reference | 2436-79-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1H-Pyrrole-2,4-dicarboxylic acid, 3,5-dimethyl-, diethyl ester(2436-79-5) |
Description and Uses
Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate can be used in organic synthesis and experimental research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339900 |
