A3404912
2,7-Dichlorofluorene , 97% , 7012-16-0
CAS NO.：7012-16-0
Empirical Formula: C13H8Cl2
Molecular Weight: 235.11
MDL number: MFCD00032840
EINECS: 676-989-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB29.60 | In Stock |
|
| 5G | RMB74.40 | In Stock |
|
| 25G | RMB227.20 | In Stock |
|
| 100g | RMB649.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-128 |
| Boiling point: | 305.84°C (rough estimate) |
| Density | 1.1610 (rough estimate) |
| refractive index | 1.5610 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Very Slightly, Heated) |
| form | crystalline powder |
| color | Yellow |
| InChI | InChI=1S/C13H8Cl2/c14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12/h1-4,6-7H,5H2 |
| InChIKey | SDPURBHAHVFTGX-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(Cl)=C2)C2=C1C=C(Cl)C=C2 |
| CAS DataBase Reference | 7012-16-0(CAS DataBase Reference) |
Description and Uses
Intermediate in the production of Lumefantrine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| Hazard Note | Irritant |
| HS Code | 2903998090 |
