A3405612
3,5-Dimethyl-1,2-cyclopentadione , ≥97% , 13494-07-0
CAS NO.:13494-07-0
Empirical Formula: C7H10O2
Molecular Weight: 126.15
MDL number: MFCD00143076
EINECS: 236-811-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB119.20 | In Stock |
|
| 5G | RMB479.20 | In Stock |
|
| 25G | RMB1359.20 | In Stock |
|
| 100G | RMB3807.20 | In Stock |
|
| 500g | RMB11999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-95 °C(lit.) |
| Boiling point: | 187.4±9.0 °C(Predicted) |
| Density | 1.036±0.06 g/cm3(Predicted) |
| FEMA | 3269 | 3,5-DIMETHYL-1,2-CYCLOPENTADIONE |
| storage temp. | 2-8°C |
| Odor | at 1.00 % in propylene glycol. caramellic burnt sugar brown maple toffee molasses whiskey nutty coffee |
| Appearance | White to off-white Solid |
| Odor Type | caramellic |
| biological source | synthetic |
| JECFA Number | 421 |
| Major Application | flavors and fragrances |
| InChI | InChI=1S/C7H10O2/c1-4-3-5(2)7(9)6(4)8/h4-5H,3H2,1-2H3 |
| InChIKey | MIDXCONKKJTLDX-UHFFFAOYSA-N |
| SMILES | C1(=O)C(C)CC(C)C1=O |
| LogP | 0.53 |
| NIST Chemistry Reference | 1,2-Cyclopentanedione, 3,5-dimethyl-(13494-07-0) |
| EPA Substance Registry System | 1,2-Cyclopentanedione, 3,5-dimethyl- (13494-07-0) |
Description and Uses
flavors and fragrances
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |





