A3405812
3,5-Dimethylpiperidine (<i>cis</i>- and <i>trans</i>- mixture) , ≥96.0%(GC) , 35794-11-7
Synonym(s):
3,5-Lupetidine
CAS NO.:35794-11-7
Empirical Formula: C7H15N
Molecular Weight: 113.2
MDL number: MFCD00005996
EINECS: 252-730-6
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB23.20 | In Stock |
|
| 25ML | RMB36.00 | In Stock |
|
| 100ML | RMB108.00 | In Stock |
|
| 500ML | RMB495.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 144 °C(lit.) |
| Density | 0.853 g/mL at 25 °C(lit.) |
| vapor pressure | 6.47hPa at 25℃ |
| refractive index | n |
| Flash point: | 91 °F |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | Liquid |
| pka | 10.52±0.10(Predicted) |
| color | Clear colorless to light yellow |
| BRN | 102638 |
| InChI | InChI=1S/C7H15N/c1-6-3-7(2)5-8-4-6/h6-8H,3-5H2,1-2H3 |
| InChIKey | IDWRJRPUIXRFRX-UHFFFAOYSA-N |
| SMILES | N1CC(C)CC(C)C1 |
| LogP | 2.02 |
| CAS DataBase Reference | 35794-11-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Piperidine, 3,5-dimethyl-(35794-11-7) |
| EPA Substance Registry System | Piperidine, 3,5-dimethyl- (35794-11-7) |
Description and Uses
Reactant for synthesis of:
Substituted bisphenol A derivatives as β-amyloid peptide aggregation inhibitors
MMP-13 selective isonipecotamide α-sulfone hydroxamates
Gem-diamines for active organocatalysts for biodiesel production
Benzimidazole inhibitors of the antigen receptor-mediated NF-κB
Reactant for Mannich reactions to form Ru(II) complexes
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36/37/39-37/39-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







