A3408112
(−)-Dimethyl <SC>D</SC>-tartrate , ≥98.0%(GC) , 13171-64-7
Synonym(s):
D -(−)-Tartaric acid dimethyl ester;Dimethyl D -tartrate
CAS NO.：13171-64-7
Empirical Formula: C6H10O6
Molecular Weight: 178.14
MDL number: MFCD00008445
EINECS: 236-118-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB95.20 | In Stock |
|
| 100G | RMB319.20 | In Stock |
|
| 500g | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57-60 °C (dec.)(lit.) |
| alpha | -21 º (c=10, H2O) |
| Boiling point: | 158 °C0.2 mm Hg(lit.) |
| Density | 1.30 |
| refractive index | -21 ° (C=1, H2O) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 11.44±0.20(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D 21°, c = 2.5 in H2O |
| BRN | 1726254 |
| InChI | InChI=1S/C6H10O6/c1-11-5(9)3(7)4(8)6(10)12-2/h3-4,7-8H,1-2H3/t3-,4-/m0/s1 |
| InChIKey | PVRATXCXJDHJJN-IMJSIDKUSA-N |
| SMILES | C(OC)(=O)[C@@H](O)[C@H](O)C(OC)=O |
| CAS DataBase Reference | 13171-64-7(CAS DataBase Reference) |
| NIST Chemistry Reference | (-)-Dimethyl D-tartrate(13171-64-7) |
Description and Uses
(-)-Dimethyl D-tartrate is mainly used in the synthesis of chiral drugs and chiral intermediates, as well as in asymmetric catalysis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36/37-26 |
| WGK Germany | 3 |
| HS Code | 29181300 |
| Storage Class | 11 - Combustible Solids |
