A3408412
2,4-Dichloropyridine-3-carboxaldehyde , ≥97% , 134031-24-6
Synonym(s):
2,4-Dichloronicotinaldehyde
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB49.60 | In Stock |
|
| 1G | RMB128.00 | In Stock |
|
| 5g | RMB428.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72-75℃ |
| Boiling point: | 261.8±35.0 °C(Predicted) |
| Density | 1.488±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to crystal |
| pka | -1.17±0.10(Predicted) |
| color | White to Orange to Green |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C6H3Cl2NO/c7-5-1-2-9-6(8)4(5)3-10/h1-3H |
| InChIKey | GWBHJHIZHNTJLA-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(Cl)=C1C=O |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





