A3408612
2,3-Dibromopyridine , ≥98.0%(GC) , 13534-89-9
CAS NO.：13534-89-9
Empirical Formula: C5H3Br2N
Molecular Weight: 236.89
MDL number: MFCD00234014
EINECS: 626-632-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB30.40 | In Stock |
|
| 5G | RMB53.60 | In Stock |
|
| 25G | RMB156.00 | In Stock |
|
| 100g | RMB616.00 | In Stock |
|
| 500g | RMB2897.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-60 °C |
| Boiling point: | 249-250°C |
| Density | 2.0383 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| Flash point: | 249-250°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | -1.57±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Water Solubility | Insoluble in water. |
| BRN | 109828 |
| InChI | InChI=1S/C5H3Br2N/c6-4-2-1-3-8-5(4)7/h1-3H |
| InChIKey | SLMHHOVQRSSRCV-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC=C1Br |
| CAS DataBase Reference | 13534-89-9(CAS DataBase Reference) |
Description and Uses
2,3-Dibromopyridine is used in the synthesis of sbstituted pyridines via bromine-magnesium exchange. It is also used to synthesize halopyridinylboronic acids and esters.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-36 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
