A3408712
2,6-Dimethyl-4-hydroxypyridine , ≥98.0%(GC) , 13603-44-6
CAS NO.：13603-44-6
Empirical Formula: C7H9NO
Molecular Weight: 123.15
MDL number: MFCD00956021
EINECS: 237-089-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB61.60 | In Stock |
|
| 25G | RMB259.20 | In Stock |
|
| 100G | RMB956.80 | In Stock |
|
| 500g | RMB4261.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230-232°C |
| Boiling point: | 351 °C |
| Density | 1,053g/cm |
| refractive index | 1,501-1,503 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly) |
| form | Solid |
| pka | 5.49±0.23(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C7H9NO/c1-5-3-7(9)4-6(2)8-5/h3-4H,1-2H3,(H,8,9) |
| InChIKey | PRAFLUMTYHBEHE-UHFFFAOYSA-N |
| SMILES | C1(C)=NC(C)=CC(O)=C1 |
| LogP | 0.190 (est) |
| CAS DataBase Reference | 13603-44-6(CAS DataBase Reference) |
Description and Uses
2,6-Dimethyl-4-hydroxypyridine is a useful synthetic intermediate. It is used in the synthesis of disubstituted pyridinyl-aminohydantoins as selective human BACE1 inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
