A3409612
Diethyl ethylidenemalonate , ≥99% , 1462-12-0
CAS NO.:1462-12-0
Empirical Formula: C9H14O4
Molecular Weight: 186.21
MDL number: MFCD00009145
EINECS: 215-965-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB46.40 | In Stock |
|
| 5G | RMB161.60 | In Stock |
|
| 25G | RMB575.20 | In Stock |
|
| 100G | RMB1659.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 115-118 °C/17 mmHg (lit.) |
| Density | 1.019 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | Clear, colourless |
| Specific Gravity | 1.019 |
| BRN | 1773932 |
| InChI | InChI=1S/C9H14O4/c1-4-7(8(10)12-5-2)9(11)13-6-3/h4H,5-6H2,1-3H3 |
| InChIKey | LBBAWVLUOZVYCC-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)/C(=C/C)/C(OCC)=O |
| CAS DataBase Reference | 1462-12-0(CAS DataBase Reference) |
| EPA Substance Registry System | Propanedioic acid, ethylidene-, diethyl ester (1462-12-0) |
Description and Uses
Diethyl Ethylidenemalonate is a useful intermediate for 1,4-addition and [3+2] cycloaddition reactions and in 2,4-dienoates synthesis.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301+H331-H315-H319-H334-H335 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P284-P302+P352-P342+P311-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P310+P330-P304+P340+P311-P403+P233-P405 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 2917198090 |
| Storage Class | 10 - Combustible liquids |








