A3410412
Carbonic Acid Di-2-pyridyl Ester , ≥98.0% , 1659-31-0
CAS NO.：1659-31-0
Empirical Formula: C11H8N2O3
Molecular Weight: 216.19
MDL number: MFCD00191407
EINECS: 213-988-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB37.60 | In Stock |
|
| 5G | RMB101.60 | In Stock |
|
| 25G | RMB399.20 | In Stock |
|
| 100g | RMB1507.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90 °C |
| Boiling point: | 351.6±17.0 °C(Predicted) |
| Density | 1.307 |
| Flash point: | 166.438℃ |
| storage temp. | Inert atmosphere,2-8°C |
| form | powder to crystal |
| pka | 0.63±0.12(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C11H8N2O3/c14-11(15-9-5-1-3-7-12-9)16-10-6-2-4-8-13-10/h1-8H |
| InChIKey | GCSAXWHQFYOIFE-UHFFFAOYSA-N |
| SMILES | C(OC1=NC=CC=C1)(=O)OC1=NC=CC=C1 |
| CAS DataBase Reference | 1659-31-0(CAS DataBase Reference) |
Description and Uses
Di-2-pyridyl carbonate is used as a coupling agent in the esterification of carboxylic acids (e.g. 3-Cyclohexenylcarboxylic acid [C988195]). Di-2-pyridyl carbonate is also used as a reagent to synthesize active carbonates (e.g. benzyl 2-pyridyl carbonate) and carbamates (e.g. 3-Pyridyl diethylcarbamate [P992950]).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 29333990 |
