A3412212
1,4-Diphenoxybenzene , >98.0%(GC) , 3061-36-7
CAS NO.：3061-36-7
Empirical Formula: C18H14O2
Molecular Weight: 262.3
MDL number: MFCD00038368
EINECS: 000-000-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB274.40 | In Stock |
|
| 100G | RMB948.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-77 °C |
| Boiling point: | 172°C 0,01mm |
| Density | 1,083 g/cm3 |
| refractive index | 1.5200 (estimate) |
| Flash point: | 202°C |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 2215945 |
| InChI | InChI=1S/C18H14O2/c1-3-7-15(8-4-1)19-17-11-13-18(14-12-17)20-16-9-5-2-6-10-16/h1-14H |
| InChIKey | UVGPELGZPWDPFP-UHFFFAOYSA-N |
| SMILES | C1(OC2=CC=CC=C2)=CC=C(OC2=CC=CC=C2)C=C1 |
| CAS DataBase Reference | 3061-36-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,4-diphenoxy-(3061-36-7) |
| EPA Substance Registry System | Benzene, 1,4-diphenoxy- (3061-36-7) |
Safety
| Safety Statements | 24/25 |
| TSCA | Yes |
| HS Code | 29029090 |
