A3415512
3,5-Dichlorobenzyl alcohol , ≥98.0%(GC) , 60211-57-6
CAS NO.：60211-57-6
Empirical Formula: C7H6Cl2O
Molecular Weight: 177.03
MDL number: MFCD00004634
EINECS: 262-109-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB42.40 | In Stock |
|
| 25G | RMB193.60 | In Stock |
|
| 100G | RMB624.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 79-82 °C (lit.) |
| Boiling point: | 251.88°C (rough estimate) |
| Density | 1.2970 (rough estimate) |
| refractive index | 1.5570 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 13.79±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to light yellow |
| BRN | 1936389 |
| InChI | InChI=1S/C7H6Cl2O/c8-6-1-5(4-10)2-7(9)3-6/h1-3,10H,4H2 |
| InChIKey | VSNNLLQKDRCKCB-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC(Cl)=CC(Cl)=C1 |
| CAS DataBase Reference | 60211-57-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Dichlorobenzyl alcohol(60211-57-6) |
Description and Uses
3,5-Dichlorobenzyl alcohol was used in the preparation of 3,5-dichlorophenylacetonitrile via reaction with boiling SOCl2, followed by reaction with NaCN. It was also used in the synthesis of tert-butyl 2-cyano-3-(3,5-dichlorophenyl)-propanoate via Iridium-catalysed alkylation of tert-butyl cyanoacetate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 36/37/39-26-22-24/25 |
| WGK Germany | 3 |
| HS Code | 29062990 |
