A3416012
3,4-Diaminobenzoic acid , ≥99% , 619-05-6
CAS NO.:619-05-6
Empirical Formula: C7H8N2O2
Molecular Weight: 152.15
MDL number: MFCD00007726
EINECS: 210-577-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB59.20 | In Stock |
|
| 100G | RMB189.60 | In Stock |
|
| 500G | RMB839.20 | In Stock |
|
| 1kg | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208-210 °C (dec.) (lit.) |
| Boiling point: | 274.61°C (rough estimate) |
| Density | 1.2804 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Powder |
| pka | 5.02±0.10(Predicted) |
| color | Brown |
| Water Solubility | Soluble in water (2.2 mg/ml at 20°C), DMF, and methanol (10 mg/ml). |
| BRN | 775892 |
| Major Application | peptide synthesis |
| Cosmetics Ingredients Functions | HAIR DYEING |
| InChI | InChI=1S/C7H8N2O2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,8-9H2,(H,10,11) |
| InChIKey | HEMGYNNCNNODNX-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(N)C(N)=C1 |
| LogP | 0.130 |
| CAS DataBase Reference | 619-05-6(CAS DataBase Reference) |
Description and Uses
3,4-Diaminobenzoic acid undergoes cyclocondensations to form, for example, quinoxalines1 and benzimidazoles. It acts as a redox label for electrochemical detection of single base mismatches.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 1 |
| Hazard Note | Irritant |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |




