A3418912
2,3-Dichlorobenzenesulfonyl chloride , ≥98% , 82417-45-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB203.20 | In Stock |
|
| 25G | RMB963.20 | In Stock |
|
| 100G | RMB3648.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-64 °C (lit.) |
| Boiling point: | 140-142 °C (2 mmHg) |
| Density | 1.636±0.06 g/cm3(Predicted) |
| Flash point: | 49 °F |
| storage temp. | 2-8°C |
| form | Powder, Crystals or Chunks |
| color | White to tan |
| Sensitive | Moisture Sensitive |
| BRN | 7703966 |
| InChI | 1S/C6H3Cl3O2S/c7-4-2-1-3-5(6(4)8)12(9,10)11/h1-3H |
| InChIKey | PQODWTNHDKDHIW-UHFFFAOYSA-N |
| SMILES | Clc1cccc(c1Cl)S(Cl)(=O)=O |
| CAS DataBase Reference | 82417-45-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H228-H314 |
| Precautionary statements | P210-P240-P260-P280-P303+P361+P353-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,C |
| Risk Statements | 11-34 |
| Safety Statements | 16-26-36/37/39-45 |
| RIDADR | UN 2925 4.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Moisture Sensitive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Eye Dam. 1 Flam. Sol. 2 Skin Corr. 1B |
| Limited Quantities | 1.0 Kg (2.2 lbs) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
