A3419112
Diphenyl phosphate , 99% , 838-85-7
CAS NO.:838-85-7
Empirical Formula: C12H11O4P
Molecular Weight: 250.19
MDL number: MFCD00003033
EINECS: 212-657-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB51.20 | In Stock |
|
| 100G | RMB158.40 | In Stock |
|
| 500G | RMB759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-66 °C (lit.) |
| Boiling point: | 280°C |
| Density | 0,76 g/cm3 |
| refractive index | 1.6250 |
| Flash point: | 4°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 1.12±0.50(Predicted) |
| form | Crystalline Powder |
| color | White |
| Water Solubility | Soluble in benzene. Insoluble in water. |
| BRN | 1379164 |
| InChI | 1S/C12H11O4P/c13-17(14,15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-10H,(H,13,14) |
| InChIKey | ASMQGLCHMVWBQR-UHFFFAOYSA-N |
| SMILES | OP(=O)(Oc1ccccc1)Oc2ccccc2 |
| CAS DataBase Reference | 838-85-7(CAS DataBase Reference) |
| EPA Substance Registry System | Diphenyl phosphate (838-85-7) |
Description and Uses
Diphenyl phosphate can be used as an organic catalyst for the ring-opening polymerization (ROP) of renewable 5-alkyl δ-lactones. In combination with zinc iodide, it forms a novel initiating system for the living cationic polymerization of isobutyl vinyl ether.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | TC5470000 |
| TSCA | TSCA listed |
| HS Code | 29190090 |
| Storage Class | 11 - Combustible Solids |






