A3419612
2,5-Dibromoadipic Acid Diethyl Ester , ≥98% , 869-10-3
CAS NO.：869-10-3
Empirical Formula: C10H16Br2O4
Molecular Weight: 360.04
MDL number: MFCD00276565
EINECS: 200-059-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB111.20 | In Stock |
|
| 100G | RMB356.80 | In Stock |
|
| 500g | RMB1624.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-67 °C (lit.) |
| Boiling point: | 134°C/0.5mmHg(lit.) |
| Density | 1.7082 (rough estimate) |
| refractive index | 1.5010 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DCM |
| form | Solid |
| color | Brown |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C10H16Br2O4/c1-3-15-9(13)7(11)5-6-8(12)10(14)16-4-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | UBCNJHBDCUBIPB-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(Br)CCC(Br)C(OCC)=O |
| CAS DataBase Reference | 869-10-3(CAS DataBase Reference) |
Description and Uses
Diethyl 2,5-dibromohexanedioate can be used as organic synthesis intermediates and pharmaceutical intermediates, mainly used in laboratory research and development processes and chemical production processes.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P271-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29171900 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
