A3424912
N,N-Diethyl-m-toluidine , >99.0%(GC) , 91-67-8
CAS NO.：91-67-8
Empirical Formula: C11H17N
Molecular Weight: 163.26
MDL number: MFCD00035795
EINECS: 202-089-3
| Pack Size | Price | Stock | Quantity |
| 25G | RMB23.20 | In Stock |
|
| 100G | RMB67.20 | In Stock |
|
| 500G | RMB237.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46.25°C (estimate) |
| Boiling point: | 97 °C (17 mmHg) |
| Density | 0.92 |
| refractive index | 1.535-1.537 |
| Flash point: | 101 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| pka | 6.84±0.30(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C11H17N/c1-4-12(5-2)11-8-6-7-10(3)9-11/h6-9H,4-5H2,1-3H3 |
| InChIKey | CIPVVROJHKLHJI-UHFFFAOYSA-N |
| SMILES | C1(N(CC)CC)=CC=CC(C)=C1 |
| CAS DataBase Reference | 91-67-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, N,N-diethyl-3-methyl-(91-67-8) |
| EPA Substance Registry System | Benzenamine, N,N-diethyl-3-methyl- (91-67-8) |
Description and Uses
N,N-Diethyl-m-toluidine is used as a recognition molecule to assay biomolecules and other constituents in lateral flow, liquid and dry chemistry techniques. N,N-Diethyl-m-toluidine is also a useful synthetic intermediate.
Safety
| Symbol(GHS) |    GHS06,GHS09,GHS07 |
| Signal word | Danger |
| Hazard statements | H301-H311-H331-H411-H302+H312+H332-H315-H319 |
| Precautionary statements | P261-P273-P280-P301+P310-P311-P264-P270-P271-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xn,N,T |
| Risk Statements | 36/37/38-20/21/22-51/53-26-24/25-20 |
| Safety Statements | 24/25-61-45-36/37-28 |
| RIDADR | UN 1708 6.1/PG 2 |
| RTECS | CX9869375 |
| HS Code | 29214300 |
