A3425312
N,N-Dimethyl-m-toluidine , >97.0%(GC) , 121-72-2
CAS NO.:121-72-2
Empirical Formula: C9H13N
Molecular Weight: 135.21
MDL number: MFCD00008305
EINECS: 204-495-6
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB31.20 | In Stock |
|
| 25ML | RMB51.20 | In Stock |
|
| 100ML | RMB155.20 | In Stock |
|
| 500ML | RMB515.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -15 °C |
| Boiling point: | 215 °C(lit.) |
| Density | 0.93 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 185 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| pka | 5.22±0.10(Predicted) |
| color | Clear yellow |
| BRN | 1422766 |
| InChI | InChI=1S/C9H13N/c1-8-5-4-6-9(7-8)10(2)3/h4-7H,1-3H3 |
| InChIKey | CWOMTHDOJCARBY-UHFFFAOYSA-N |
| SMILES | C1(N(C)C)=CC=CC(C)=C1 |
| CAS DataBase Reference | 121-72-2(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, N,N,3-trimethyl- (121-72-2) |
Description and Uses
N,N,3-Trimethylaniline, is an building block used for the synthesis of more complex compounds, such as BTK (Bruton''s tyrosine kinase) inhibitor.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H373-H412 |
| Precautionary statements | P273-P280-P301+P310+P330-P302+P352+P312-P304+P340+P311-P314 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T |
| Risk Statements | 23/24/25-33-52/53 |
| Safety Statements | 28-36/37-45-61 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 2 |
| RTECS | XU5798000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29214300 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 3 STOT RE 2 |
| Toxicity | LD50 intraperitoneal in mouse: 300mg/kg |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








