A3425412
N,N-Dimethyl-o-toluidine , >99.0%(GC) , 609-72-3
CAS NO.：609-72-3
Empirical Formula: C9H13N
Molecular Weight: 135.21
MDL number: MFCD00035789
EINECS: 210-199-8
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB79.20 | In Stock |
|
| 25ML | RMB239.20 | In Stock |
|
| 100ML | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -60°C |
| Boiling point: | 76 °C18 mm Hg(lit.) |
| Density | 0.929 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 145 °F |
| storage temp. | 2-8°C, protect from light |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| pka | pK1:5.86(+1) (25°C) |
| color | Clear colorless to amber |
| Dielectric constant | 3.3999999999999999 |
| InChI | InChI=1S/C9H13N/c1-8-6-4-5-7-9(8)10(2)3/h4-7H,1-3H3 |
| InChIKey | JDEJGVSZUIJWBM-UHFFFAOYSA-N |
| SMILES | C1(N(C)C)=CC=CC=C1C |
| CAS DataBase Reference | 609-72-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, N,N,2-trimethyl-(609-72-3) |
| EPA Substance Registry System | Benzenamine, N,N,2-trimethyl- (609-72-3) |
Description and Uses
N,N-Dimethyl-o-toluidine may be employed as starting reagent for the synthesis of roseoflavin.
Safety
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H373-H412 |
| Precautionary statements | P273-P280-P301+P310+P330-P302+P352+P312-P304+P340+P311-P314 |
| Hazard Codes | T |
| Risk Statements | 23/24/25-33-36/37/38-52/53 |
| Safety Statements | 23-26-36/37/39-45-61-36/37-28A-28 |
| RIDADR | UN 2810 6.1/PG 2 |
| WGK Germany | 1 |
| RTECS | XU5800000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29214300 |
