A3428912
Di(2-ethylhexyl)phthalate , 100μg/mlinmethanol , 117-81-7
Synonym(s):
‘Dioctyl’ phthalate;Bis(2-ethylhexyl) phthalate;DEHP;DOP;Phthalic acid bis(2-ethylhexyl ester)
CAS NO.:117-81-7
Empirical Formula: C24H38O4
Molecular Weight: 390.56
MDL number: MFCD00009493
EINECS: 204-211-0
| Pack Size | Price | Stock | Quantity |
| 1.2ML | RMB143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -50 °C |
| Boiling point: | 386 °C (lit.) |
| Density | 0.985 g/mL at 20 °C (lit.) |
| Pour Point | -46 |
| vapor density | >16 (vs air) |
| vapor pressure | 1.2 mm Hg ( 93 °C) |
| refractive index | n |
| Flash point: | 405 °F |
| storage temp. | 2-8°C |
| solubility | Miscible with mineral oil and hexane (U.S. EPA, 1985) |
| form | Liquid |
| color | APHA: ≤10 |
| Odor | Very slight, characteristic. |
| Water Solubility | Negligible |
| FreezingPoint | <-60℃ |
| Merck | 14,2864 |
| BRN | 1890696 |
| Henry's Law Constant | (x 10-5 atm?m3/mol):
1.1 at 25 °C (calculated, Howard, 1989) |
| Exposure limits | Potential occupational carcinogen. NIOSH REL: TWA 5, STEL 10,
IDLH 5,000; OSHA PEL: TWA 5; ACGIH TLV: TWA 5 (adopted). |
| Dielectric constant | 5.1(24℃) |
| Cosmetics Ingredients Functions | PLASTICISER PERFUMING SOLVENT FRAGRANCE |
| InChI | 1S/C24H38O4/c1-5-9-13-19(7-3)17-27-23(25)21-15-11-12-16-22(21)24(26)28-18-20(8-4)14-10-6-2/h11-12,15-16,19-20H,5-10,13-14,17-18H2,1-4H3 |
| InChIKey | BJQHLKABXJIVAM-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)c1ccccc1C(=O)OCC(CC)CCCC |
| LogP | 7.5 at 20℃ |
| CAS DataBase Reference | 117-81-7(CAS DataBase Reference) |
| IARC | 2B (Vol. Sup 7, 77, 101) 2013 |
| NIST Chemistry Reference | Bis(2-ethylhexyl)phthalate(117-81-7) |
| EPA Substance Registry System | Di(2-ethylhexyl) phthalate (117-81-7) |
Description and Uses
Di(2-ethylhexyl)phthalate is a colorless oilyliquid with almost no odor. Molecular weight=390.56;Specific gravity (H2O:1)=0.99; Boiling point=385℃;Freezing/Melting point=-50℃; Vapor pressure=,0.01% mmHg at 20℃; Flash point=195℃;Autoignition temperature=348℃. Explosive limits:LEL=0.1%; UEL 2 0.2%. Hazard Identification (based onNFPA-704 M Rating System): Health 1, Flammability 1,Reactivity 0. Slightly soluble in water;solubility=0.00003% at 25℃.
As plasticizer in PVC applications and flexible vinyls.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H360FD |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,F |
| Risk Statements | 60-61-39/23/24/25-23/24/25-11 |
| Safety Statements | 53-45-36/37-16 |
| OEB | B |
| OEL | TWA: 5 mg/m3, STEL: 10 mg/m3 |
| RIDADR | UN 1230 3/PG 2 |
| WGK Germany | 1 |
| RTECS | TI0350000 |
| Autoignition Temperature | 734 °F |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29173400 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B |
| Hazardous Substances Data | 117-81-7(Hazardous Substances Data) |
| Toxicity | Acute oral LD50 for guinea pigs 26 gm/kg, mice 30 gm/kg, rats 30,600 mg/kg, rabbits 34 gm/kg (quoted, RTECS, 1985). |
| IDLA | 5,000 mg/m3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




