A3433312
1-(2,6-Dichlorophenyl)oxindole , 98% , 15362-40-0
Synonym(s):
N-(2,6-Dichlorophenyl)-2-indolinone;1-(2,6-Dichlorophenyl)-1,3-dihydro-2H-indol-2-one;NSC 621845
CAS NO.:15362-40-0
Empirical Formula: C14H9Cl2NO
Molecular Weight: 278.13
MDL number: MFCD00451393
EINECS: 239-399-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB72.00 | In Stock |
|
| 25G | RMB168.80 | In Stock |
|
| 100g | RMB368.00 | In Stock |
|
| 500g | RMB1316.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-119°C |
| Boiling point: | 488.6±45.0 °C(Predicted) |
| Density | 1.432±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | -4.85±0.20(Predicted) |
| form | solid |
| color | Off-White to Light Brown |
| BRN | 1538309 |
| Stability: | Stability |
| InChI | 1S/C14H9Cl2NO/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(17)18/h1-7H,8H2 |
| InChIKey | JCICIFOYVSPMHG-UHFFFAOYSA-N |
| SMILES | Clc1cccc(Cl)c1N2C(=O)Cc3ccccc23 |
| CAS DataBase Reference | 15362-40-0(CAS DataBase Reference) |
Description and Uses
1-(2,6-Dichlorophenyl)indolin-2-one is a potential prodrug of Diclofenac and possible impurity during its commercial synthesis. It is Aceclofenac EP Impurity I and Diclofenac Impurity A.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | NM3259200 |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | mouse,LD50,unreported,1200mg/kg (1200mg/kg),Pharmaceutical Chemistry Journal Vol. 21, Pg. 275, 1987. |







