A3436712
                    1-[(3,3-Diphenylpropyl)(methyl)amino]-2-methyl-2-propanol , >98.0%(GC) , 100442-33-9
CAS NO.:100442-33-9
Empirical Formula: C20 H27 N O
Molecular Weight: 297.43
MDL number: MFCD07782118
EINECS: 239-349-0
| Pack Size | Price | Stock | Quantity | 
| 1g | RMB61.60 | In Stock | 
                                                 | 
                                        
| 5G | RMB72.80 | In Stock | 
                                                 | 
                                        
| 10G | RMB144.00 | In Stock | 
                                                 | 
                                        
| 25G | RMB172.00 | In Stock | 
                                                 | 
                                        
| 100g | RMB607.20 | In Stock | 
                                                 | 
                                        
| 500g | RMB2639.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Boiling point: | 145°C/0.2mmHg(lit.) | 
                                    
| Density | 1.025±0.06 g/cm3(Predicted) | 
                                    
| refractive index | 1.5430 to 1.5470 | 
                                    
| storage temp. | Sealed in dry,Room Temperature | 
                                    
| solubility | Chloroform (Slightly), Methanol (Slightly) | 
                                    
| pka | 14.90±0.29(Predicted) | 
                                    
| form | Oil | 
                                    
| color | Colourless to Pale Yellow | 
                                    
| Stability: | Normal temperature and pressure | 
                                    
| InChI | InChI=1S/C20H27NO/c1-20(2,22)16-21(3)15-14-19(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,19,22H,14-16H2,1-3H3 | 
                                    
| InChIKey | MQWDISMNBYOLAB-UHFFFAOYSA-N | 
                                    
| SMILES | C(C1C=CC=CC=1)(C1C=CC=CC=1)CCN(C)CC(O)(C)C | 
                                    
| CAS DataBase Reference | 100442-33-9(CAS DataBase Reference) | 
                                    
Description and Uses
Lercanidipine Intermediate.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H302 | 
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P-P264-P270-P301+P312-P330-P501 | 
| HS Code | 2922.19.7000 | 

![1-[(3,3-Diphenylpropyl)(methyl)amino]-2-methyl-2-propanol](https://img.chemicalbook.com/CAS/GIF/100442-33-9.gif)




