A3452012
7-Diethylamino-4-methylcoumarin , 98% , 91-44-1
Synonym(s):
Coumarin 1
CAS NO.:91-44-1
Empirical Formula: C14H17NO2
Molecular Weight: 231.29
MDL number: MFCD00006864
EINECS: 202-068-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB40.00 | In Stock |
|
| 100G | RMB124.80 | In Stock |
|
| 500G | RMB439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72-75 °C (lit.) |
| Boiling point: | 240 °C / 6.5mmHg |
| Density | 1.122 |
| vapor pressure | 0-0.003Pa at 20-25℃ |
| refractive index | 1.5300 (estimate) |
| Flash point: | 152°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | 3.51±0.20(Predicted) |
| color | Light beige to light purple |
| Water Solubility | slightly soluble |
| BRN | 193303 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | LIGHT STABILIZER |
| InChI | 1S/C14H17NO2/c1-4-15(5-2)11-6-7-12-10(3)8-14(16)17-13(12)9-11/h6-9H,4-5H2,1-3H3 |
| InChIKey | AFYCEAFSNDLKSX-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc2C(C)=CC(=O)Oc2c1 |
| LogP | 2.523-2.8 at 23-25℃ |
| CAS DataBase Reference | 91-44-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Coumarin, 7-(diethylamino)-4-methyl-(91-44-1) |
| EPA Substance Registry System | 7-Diethylamino-4-methylcoumarin (91-44-1) |
Description and Uses
7-(Diethylamino)-4-methylcoumarin, is potentially useful as a laser dye.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-20/21 |
| Safety Statements | 37/39-26 |
| WGK Germany | 2 |
| RTECS | GN6370000 |
| TSCA | TSCA listed |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 91-44-1(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 5gm/kg |



