A3454912
4-Decanol , >95.0%(GC) , 2051-31-2
CAS NO.：2051-31-2
Empirical Formula: C10H22O
Molecular Weight: 158.28
MDL number: MFCD00039627
EINECS: 218-117-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB63.20 | In Stock |
|
| 5g | RMB207.20 | In Stock |
|
| 10G | RMB324.00 | In Stock |
|
| 25g | RMB719.20 | In Stock |
|
| 100g | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -11.4°C |
| Boiling point: | 210-211 °C |
| Density | 0.82 |
| refractive index | 1.431-1.433 |
| Flash point: | 82 °C |
| form | clear liquid |
| pka | 15.44±0.20(Predicted) |
| color | Colorless to Light yellow |
| BRN | 1735252 |
| InChI | InChI=1S/C10H22O/c1-3-5-6-7-9-10(11)8-4-2/h10-11H,3-9H2,1-2H3 |
| InChIKey | DTDMYWXTWWFLGJ-UHFFFAOYSA-N |
| SMILES | CCCC(O)CCCCCC |
| LogP | 3.740 (est) |
| CAS DataBase Reference | 2051-31-2(CAS DataBase Reference) |
Description and Uses
4-Decanol is an antimutagenic compound, that can be isolated from mustard leaves. 4-Decanol inhibits mutagenic activities of Aflatoxin B1 (HY-N6615) and MNNG (HY-128612) in Salmonella typhimurium TA100[1][2].
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P501a-P210-P280-P370+P378-P403+P235-P501 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 24/25-37/39-36-26 |
| RIDADR | UN1993 |
| HS Code | 2905.19.9090 |
| HazardClass | 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
