A3460612
2,4-Dichloropyridine , >98.0%(GC) , 26452-80-2
CAS NO.：26452-80-2
Empirical Formula: C5H3Cl2N
Molecular Weight: 147.99
MDL number: MFCD00955618
EINECS: 247-717-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB89.60 | In Stock |
|
| 100G | RMB265.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -1 °C |
| Boiling point: | 189-190 °C (lit.)
76-78 °C/23 mmHg (lit.) |
| Density | 1.37 |
| refractive index | 1.55-1.554 |
| Flash point: | 189-190°C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform |
| form | Yellow to Pale Orange Liquid |
| pka | 0.12±0.10(Predicted) |
| color | Colorless to Red to Green |
| BRN | 108666 |
| InChI | InChI=1S/C5H3Cl2N/c6-4-1-2-8-5(7)3-4/h1-3H |
| InChIKey | TYPVHTOETJVYIV-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(Cl)=C1 |
| CAS DataBase Reference | 26452-80-2(CAS DataBase Reference) |
Description and Uses
2,4-Dichloropyridine is a versatile reactant used in the preparation of host materials for light-emitting diodes with heterocyclic cores. Also used in the preparation of sulfonylated pyridines, pyrazine and quinoline via aromatic nucleophilic substitution of azines with sodium sulfinates.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H318 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | T,Xi,Xn |
| Risk Statements | 25-38-41-43-36/37/38-20/22 |
| Safety Statements | 26-36/37/39-45-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | NC3410400 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
