A3478612
1,4-Dihydro-2,6-dimethyl-3,5-pyridinedicarboxylic Acid Di-tert-butyl Ester , >98.0%(HPLC)(T) , 55536-71-5
Synonym(s):
2,6-Dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid di-tert-butyl ester
| Pack Size | Price | Stock | Quantity |
| 1G | RMB444.80 | In Stock |
|
| 5G | RMB1418.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142-149 °C |
| Boiling point: | 389.9±42.0 °C(Predicted) |
| Density | 1.047±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 3.34±0.70(Predicted) |
| color | White to Orange to Green |
| InChI | 1S/C17H27NO4/c1-10-12(14(19)21-16(3,4)5)9-13(11(2)18-10)15(20)22-17(6,7)8/h18H,9H2,1-8H3 |
| InChIKey | WSWDAKKWVAVVAI-UHFFFAOYSA-N |
| SMILES | CC1=C(CC(=C(C)N1)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| HS Code | 2933.39.9200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
