A3479612
1,3-Di(4-pyridyl)propane , >97.0%(GC) , 17252-51-6
Synonym(s):
1,3-Bis(4-pyridyl)propane
CAS NO.：17252-51-6
Empirical Formula: C13H14N2
Molecular Weight: 198.26
MDL number: MFCD00038046
EINECS: 241-284-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB74.40 | In Stock |
|
| 25G | RMB226.40 | In Stock |
|
| 100G | RMB812.00 | In Stock |
|
| 500g | RMB2944.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57-60 °C(lit.) |
| Boiling point: | 142°C 2mm |
| Density | 1.066±0.06 g/cm3(Predicted) |
| Flash point: | 142°C/2mm |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Slightly soluble in water |
| form | crystal |
| pka | 6.30±0.10(Predicted) |
| color | light yellow |
| Sensitive | Hygroscopic |
| BRN | 150231 |
| InChI | InChI=1S/C13H14N2/c1(2-12-4-8-14-9-5-12)3-13-6-10-15-11-7-13/h4-11H,1-3H2 |
| InChIKey | OGNCVVRIKNGJHQ-UHFFFAOYSA-N |
| SMILES | C(C1C=CN=CC=1)CCC1C=CN=CC=1 |
| CAS DataBase Reference | 17252-51-6(CAS DataBase Reference) |
| EPA Substance Registry System | Pyridine, 4,4'-(1,3-propanediyl)bis- (17252-51-6) |
Description and Uses
4,4′-Trimethylenedipyridine was used as ligand to study the solvent effects on the formal potential of redox-active self-assembling system [Os(bpy)2(dipy)Cl]1+ (bpy= 2,2′-bipyridine, dipy= 4,4′-Trimethylenedipyridine) in different organic solvents and aqueous solutions. It was used in the synthesis of two- and three-dimensional cadmium-organic frameworks.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-28-36/37/39-45 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29333990 |
