A3480612
Dibenzo-24-crown 8-Ether , >98.0% , 14174-09-5
Synonym(s):
2,3,14,15-Dibenzo-1,4,7,10,13,16,19,22-octaoxacyclotetracosa-2,14-diene;6,7,9,10,12,13,20,21,23,24,26,27-Dodecahydrodibenz[b,n]-1,4,7,10,13,16,19,22-octaoxacyclotetracosane;Crown ether/Dibenzo-24-crown-8;Dibenzo-24-crown-8, 1,4,7,10,17,20,23,26-Octaoxa[10.10]orthocyclophane
CAS NO.:14174-09-5
Empirical Formula: C24H32O8
Molecular Weight: 448.51
MDL number: MFCD00005101
EINECS: 238-027-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB51.20 | In Stock |
|
| 1G | RMB293.60 | In Stock |
|
| 5G | RMB950.40 | In Stock |
|
| 25g | RMB3192.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 103-105 °C(lit.) |
| Boiling point: | 517.23°C (rough estimate) |
| Density | 1.1606 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | almost transparency in hot Methanol |
| form | crystal |
| color | white |
| Sensitive | air sensitive |
| BRN | 1693744 |
| InChI | InChI=1S/C24H32O8/c1-2-6-22-21(5-1)29-17-13-25-9-10-27-15-19-31-23-7-3-4-8-24(23)32-20-16-28-12-11-26-14-18-30-22/h1-8H,9-20H2 |
| InChIKey | UNTITLLXXOKDTB-UHFFFAOYSA-N |
| SMILES | O1CCOCCOCCOC2=CC=CC=C2OCCOCCOCCOC2=CC=CC=C12 |
| CAS DataBase Reference | 14174-09-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetracosamethylcyclododecasiloxane(14174-09-5) |
Description and Uses
Dibenzo-24-crown-8 can be used as a molecular transporter in the formation of [1]rotaxanes with thiazolium-based mono- and tris-branched ammonium ions. It is also used as a co-solvent and phase-transfer catalyst for cesium fluoride, to the development of a more efficient anhydrous fluorinating system for organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29329995 |
| Storage Class | 11 - Combustible Solids |




